CAS 1210752-66-1 appears in our catalog under these names: 2,2,2-Trifluoroethyl N-(4-methyl-2-oxo-2H-chromen-7-yl)carbamate, 95%, 2,2,2-Trifluoroethyl N-(4-methyl-2-oxo-2H-chromen-7-yl)carbamate. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 2,5g, 250mg.
2,2,2-trifluoroethyl N-(4-methyl-2-oxochromen-7-yl)carbamate (CAS 1210752-66-1) is a chemical compound with the molecular formula C13H10F3NO4 and a molecular weight of 301.22 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-(4-methyl-2-oxochromen-7-yl)carbamate. InChIKey: PLKKCAVIEHUKIH-UHFFFAOYSA-N.
| Molecular formula | C13H10F3NO4 |
|---|---|
| Molecular weight | 301.22 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl N-(4-methyl-2-oxochromen-7-yl)carbamate |
| InChIKey | PLKKCAVIEHUKIH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)