CAS 1210782-09-4 is the registry number for N,N'-Bis(4-fluorobenzoyl)methylhydrazine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-fluoro-N'-(4-fluorobenzoyl)-N'-methylbenzohydrazide (CAS 1210782-09-4) is a chemical compound with the molecular formula C15H12F2N2O2 and a molecular weight of 290.26 g/mol. IUPAC name: 4-fluoro-N'-(4-fluorobenzoyl)-N'-methylbenzohydrazide. InChIKey: ULKNQKSXZBQKRP-UHFFFAOYSA-N.
| Molecular formula | C15H12F2N2O2 |
|---|---|
| Molecular weight | 290.26 g/mol |
| IUPAC name | 4-fluoro-N'-(4-fluorobenzoyl)-N'-methylbenzohydrazide |
| InChIKey | ULKNQKSXZBQKRP-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C1=CC=C(C=C1)F)NC(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)