CAS 121088-14-0 is the registry number for 3-(tert-Butoxy)-1,2,4,5-tetrafluorobenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2,4,5-tetrafluoro-3-[(2-methylpropan-2-yl)oxy]benzene (CAS 121088-14-0) is a chemical compound with the molecular formula C10H10F4O and a molecular weight of 222.18 g/mol. IUPAC name: 1,2,4,5-tetrafluoro-3-[(2-methylpropan-2-yl)oxy]benzene. InChIKey: UDSOOPKRNJVUIV-UHFFFAOYSA-N.
| Molecular formula | C10H10F4O |
|---|---|
| Molecular weight | 222.18 g/mol |
| IUPAC name | 1,2,4,5-tetrafluoro-3-[(2-methylpropan-2-yl)oxy]benzene |
| InChIKey | UDSOOPKRNJVUIV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=C(C(=CC(=C1F)F)F)F |
Computed by PubChem (NCBI)