Products 121098-45-1
CAS 121098-45-1 appears in our catalog under these names: Fenpropimorph-carboxylic acid, Fenpropimorph acid, Fenpropimorph acid Metabolite. Offered by: Dr. Ehrenstorfer, Biosynth, HPC Standards. Available pack sizes: 10mg, 25mg, 50mg.
2-[4-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-methylpropyl]phenyl]-2-methylpropanoic acid (CAS 121098-45-1) is a chemical compound with the molecular formula C20H31NO3 and a molecular weight of 333.5 g/mol. IUPAC name: 2-[4-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-methylpropyl]phenyl]-2-methylpropanoic acid. InChIKey: OZMMLYFAEKBWEE-MQVJKMGUSA-N.
| Molecular formula | C20H31NO3 |
|---|---|
| Molecular weight | 333.5 g/mol |
| IUPAC name | 2-[4-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-methylpropyl]phenyl]-2-methylpropanoic acid |
| InChIKey | OZMMLYFAEKBWEE-MQVJKMGUSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](O1)C)CC(C)CC2=CC=C(C=C2)C(C)(C)C(=O)O |
Computed by PubChem (NCBI)