CAS 1211-37-6 appears in our catalog under these names: 2,7–Dibromoacridine, 2,7-Dibromoacridine, 95%, 95%, 2,7-Dibromoacridine, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
2,7-dibromoacridine (CAS 1211-37-6) is a chemical compound with the molecular formula C13H7Br2N and a molecular weight of 337.01 g/mol. IUPAC name: 2,7-dibromoacridine. InChIKey: MGAAUJYLQGQIOK-UHFFFAOYSA-N.
| Molecular formula | C13H7Br2N |
|---|---|
| Molecular weight | 337.01 g/mol |
| IUPAC name | 2,7-dibromoacridine |
| InChIKey | MGAAUJYLQGQIOK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C=C3C=C(C=CC3=N2)Br |
Computed by PubChem (NCBI)