CAS 12110-21-3 is the registry number for Tetrapropylammoniumhexafluorophosphate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tetrapropylazanium hexafluorophosphate (CAS 12110-21-3) is a chemical compound with the molecular formula C12H28F6NP and a molecular weight of 331.32 g/mol. IUPAC name: tetrapropylazanium hexafluorophosphate. InChIKey: GSYVZOSIIKEIBZ-UHFFFAOYSA-N.
| Molecular formula | C12H28F6NP |
|---|---|
| Molecular weight | 331.32 g/mol |
| IUPAC name | tetrapropylazanium hexafluorophosphate |
| InChIKey | GSYVZOSIIKEIBZ-UHFFFAOYSA-N |
| SMILES | CCC[N+](CCC)(CCC)CCC.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)