CAS 121115-30-8 appears in our catalog under these names: 2,5-dioxo-1-(3-(pyridin-2-yldisulfanyl)propanoyloxy)pyrrolidine-3-sulfonic acid, 98+%, SPDP-sulfo. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
2,5-dioxo-1-[3-(pyridin-2-yldisulfanyl)propanoyloxy]pyrrolidine-3-sulfonic acid (CAS 121115-30-8) is a chemical compound with the molecular formula C12H12N2O7S3 and a molecular weight of 392.4 g/mol. IUPAC name: 2,5-dioxo-1-[3-(pyridin-2-yldisulfanyl)propanoyloxy]pyrrolidine-3-sulfonic acid. InChIKey: MRKXZYGMIDQTPG-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O7S3 |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | 2,5-dioxo-1-[3-(pyridin-2-yldisulfanyl)propanoyloxy]pyrrolidine-3-sulfonic acid |
| InChIKey | MRKXZYGMIDQTPG-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)N(C1=O)OC(=O)CCSSC2=CC=CC=N2)S(=O)(=O)O |
Computed by PubChem (NCBI)