CAS 1211190-65-6 is the registry number for 2-(((5-Chloro-1,2,3-thiadiazol-4-yl)methyl)thio)-6-methylpyrimidin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(5-chlorothiadiazol-4-yl)methylsulfanyl]-6-methylpyrimidin-4-amine (CAS 1211190-65-6) is a chemical compound with the molecular formula C8H8ClN5S2 and a molecular weight of 273.8 g/mol. IUPAC name: 2-[(5-chlorothiadiazol-4-yl)methylsulfanyl]-6-methylpyrimidin-4-amine. InChIKey: IBGPMBRESCALRK-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN5S2 |
|---|---|
| Molecular weight | 273.8 g/mol |
| IUPAC name | 2-[(5-chlorothiadiazol-4-yl)methylsulfanyl]-6-methylpyrimidin-4-amine |
| InChIKey | IBGPMBRESCALRK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)SCC2=C(SN=N2)Cl)N |
Computed by PubChem (NCBI)