CAS 1211199-35-7 appears in our catalog under these names: 2,2,2-Trifluoroethyl n-(1,3,4-thiadiazol-2-yl)carbamate, 95%, 2,2,2-Trifluoroethyl N-(1,3,4-thiadiazol-2-yl)carbamate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2,2,2-trifluoroethyl N-(1,3,4-thiadiazol-2-yl)carbamate (CAS 1211199-35-7) is a chemical compound with the molecular formula C5H4F3N3O2S and a molecular weight of 227.17 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-(1,3,4-thiadiazol-2-yl)carbamate. InChIKey: CIWFWHVLSORFJS-UHFFFAOYSA-N.
| Molecular formula | C5H4F3N3O2S |
|---|---|
| Molecular weight | 227.17 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl N-(1,3,4-thiadiazol-2-yl)carbamate |
| InChIKey | CIWFWHVLSORFJS-UHFFFAOYSA-N |
| SMILES | C1=NN=C(S1)NC(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)