CAS 12113-07-4 appears in our catalog under these names: Triphenylborane–Sodi Triphenylborane, Borate(1-), hydroxytriphenyl-, sodium (1:1), (T-4)-, 7-10%w/w in Water, 7-10%w/w in Water. Offered by: GLPBio, Chemat. Available pack sizes: 100g, 25g, 500g, 5g, 10g, 15g, 50g, 75g.
Sodium;triphenylborane;hydroxide (CAS 12113-07-4) is a chemical compound with the molecular formula C18H16BNaO and a molecular weight of 282.1 g/mol. IUPAC name: sodium;triphenylborane;hydroxide. InChIKey: NBZUMVYYQTYYAN-UHFFFAOYSA-M.
| Molecular formula | C18H16BNaO |
|---|---|
| Molecular weight | 282.1 g/mol |
| IUPAC name | sodium;triphenylborane;hydroxide |
| InChIKey | NBZUMVYYQTYYAN-UHFFFAOYSA-M |
| SMILES | B(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[OH-].[Na+] |
Computed by PubChem (NCBI)