CAS 1211455-32-1 is the registry number for 3-Chloro-2,2-dimethyl-n-(4-methylphenyl)propanamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-chloro-2,2-dimethyl-N-(4-methylphenyl)propanamide (CAS 1211455-32-1) is a chemical compound with the molecular formula C12H16ClNO and a molecular weight of 225.71 g/mol. IUPAC name: 3-chloro-2,2-dimethyl-N-(4-methylphenyl)propanamide. InChIKey: UBFPHQBTPIQTCH-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO |
|---|---|
| Molecular weight | 225.71 g/mol |
| IUPAC name | 3-chloro-2,2-dimethyl-N-(4-methylphenyl)propanamide |
| InChIKey | UBFPHQBTPIQTCH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC(=O)C(C)(C)CCl |
Computed by PubChem (NCBI)