Products 1211516-54-9
CAS 1211516-54-9 is the registry number for 6-METHYL-3-(TRIFLUOROMETHYL)PICOLINIC ACID, ≥97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
6-methyl-3-(trifluoromethyl)pyridine-2-carboxylic acid (CAS 1211516-54-9) is a chemical compound with the molecular formula C8H6F3NO2 and a molecular weight of 205.13 g/mol. IUPAC name: 6-methyl-3-(trifluoromethyl)pyridine-2-carboxylic acid. InChIKey: WPNDTSMQDVUDDK-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO2 |
|---|---|
| Molecular weight | 205.13 g/mol |
| IUPAC name | 6-methyl-3-(trifluoromethyl)pyridine-2-carboxylic acid |
| InChIKey | WPNDTSMQDVUDDK-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(C=C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)