CAS 1211518-11-4 appears in our catalog under these names: 4-Chloro-6-(trifluoromethyl)-1,3,5-triazin-2-amine, 4-Chloro-6-(trifluoromethyl)-1,3,5-triazin-2-amine, 98%, 98%, 4-Chloro-6-(trifluoromethyl)-1,3,5-triazin-2-amine, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 1g, 100mg, 250mg.
4-chloro-6-(trifluoromethyl)-1,3,5-triazin-2-amine (CAS 1211518-11-4) is a chemical compound with the molecular formula C4H2ClF3N4 and a molecular weight of 198.53 g/mol. IUPAC name: 4-chloro-6-(trifluoromethyl)-1,3,5-triazin-2-amine. InChIKey: ITXUBIMPBJDSJU-UHFFFAOYSA-N.
| Molecular formula | C4H2ClF3N4 |
|---|---|
| Molecular weight | 198.53 g/mol |
| IUPAC name | 4-chloro-6-(trifluoromethyl)-1,3,5-triazin-2-amine |
| InChIKey | ITXUBIMPBJDSJU-UHFFFAOYSA-N |
| SMILES | C1(=NC(=NC(=N1)Cl)N)C(F)(F)F |
Computed by PubChem (NCBI)