Products 1211529-38-2
CAS 1211529-38-2 is the registry number for 6-Bromo-2-chloro-3-(trifluoromethyl)pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-2-chloro-3-(trifluoromethyl)pyridine (CAS 1211529-38-2) is a chemical compound with the molecular formula C6H2BrClF3N and a molecular weight of 260.44 g/mol. IUPAC name: 6-bromo-2-chloro-3-(trifluoromethyl)pyridine. InChIKey: JTMOVCZBQJEIDB-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClF3N |
|---|---|
| Molecular weight | 260.44 g/mol |
| IUPAC name | 6-bromo-2-chloro-3-(trifluoromethyl)pyridine |
| InChIKey | JTMOVCZBQJEIDB-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(F)(F)F)Cl)Br |
Computed by PubChem (NCBI)