CAS 1211533-31-1 appears in our catalog under these names: 5-Chloro-1,6-dihydro-1-methyl-7h-pyrazolo[4,3-d]pyrimidin-7-one, 95%, 5-Chloro-1-methyl-1H-pyrazolo(4,3-d)pyrimidin-7(6H)-one, 97%, 5-chloro-1,6-dihydro-1-methyl-7h-pyrazolo(4,3-d)pyrimidin-7-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 5g, 0,5g, 50mg.
5-chloro-1-methyl-6H-pyrazolo[4,5-d]pyrimidin-7-one (CAS 1211533-31-1) is a chemical compound with the molecular formula C6H5ClN4O and a molecular weight of 184.58 g/mol. IUPAC name: 5-chloro-1-methyl-6H-pyrazolo[4,5-d]pyrimidin-7-one. InChIKey: HEVALVXRWWOOAZ-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN4O |
|---|---|
| Molecular weight | 184.58 g/mol |
| IUPAC name | 5-chloro-1-methyl-6H-pyrazolo[4,5-d]pyrimidin-7-one |
| InChIKey | HEVALVXRWWOOAZ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=N1)N=C(NC2=O)Cl |
Computed by PubChem (NCBI)