CAS 1211538-57-6 is the registry number for 3-(BOC-Amino)-5-bromopicoline, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 25g, 100g, 5g.
Tert-butyl N-(5-bromo-2-methyl-3-pyridinyl)carbamate (CAS 1211538-57-6) is a chemical compound with the molecular formula C11H15BrN2O2 and a molecular weight of 287.15 g/mol. IUPAC name: tert-butyl N-(5-bromo-2-methyl-3-pyridinyl)carbamate. InChIKey: FZEYTKWKUSLYOQ-UHFFFAOYSA-N.
| Molecular formula | C11H15BrN2O2 |
|---|---|
| Molecular weight | 287.15 g/mol |
| IUPAC name | tert-butyl N-(5-bromo-2-methyl-3-pyridinyl)carbamate |
| InChIKey | FZEYTKWKUSLYOQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=N1)Br)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)