Products 1211541-62-6

CAS 1211541-62-6 is the registry number for 3-Pentafluorosulfanyl-5-bromo-benzoic acid methyl ester, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 3-bromo-5-(pentafluoro-lambda6-sulfanyl)benzoate (CAS 1211541-62-6) is a chemical compound with the molecular formula C8H6BrF5O2S and a molecular weight of 341.09 g/mol. IUPAC name: methyl 3-bromo-5-(pentafluoro-lambda6-sulfanyl)benzoate. InChIKey: UJJWWMYCMCGQBE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6BrF5O2S
Molecular weight341.09 g/mol
IUPAC namemethyl 3-bromo-5-(pentafluoro-lambda6-sulfanyl)benzoate
InChIKeyUJJWWMYCMCGQBE-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=CC(=C1)Br)S(F)(F)(F)(F)F

Computed by PubChem (NCBI)