CAS 1211541-62-6 is the registry number for 3-Pentafluorosulfanyl-5-bromo-benzoic acid methyl ester, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-bromo-5-(pentafluoro-lambda6-sulfanyl)benzoate (CAS 1211541-62-6) is a chemical compound with the molecular formula C8H6BrF5O2S and a molecular weight of 341.09 g/mol. IUPAC name: methyl 3-bromo-5-(pentafluoro-lambda6-sulfanyl)benzoate. InChIKey: UJJWWMYCMCGQBE-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF5O2S |
|---|---|
| Molecular weight | 341.09 g/mol |
| IUPAC name | methyl 3-bromo-5-(pentafluoro-lambda6-sulfanyl)benzoate |
| InChIKey | UJJWWMYCMCGQBE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)Br)S(F)(F)(F)(F)F |
Computed by PubChem (NCBI)