CAS 1211583-96-8 is the registry number for 3-Bromo-6-(trifluoromethyl)picolinonitrile, 97%, 97%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
3-bromo-6-(trifluoromethyl)pyridine-2-carbonitrile (CAS 1211583-96-8) is a chemical compound with the molecular formula C7H2BrF3N2 and a molecular weight of 251.00 g/mol. IUPAC name: 3-bromo-6-(trifluoromethyl)pyridine-2-carbonitrile. InChIKey: GRYWQCYIUBGZKN-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF3N2 |
|---|---|
| Molecular weight | 251.00 g/mol |
| IUPAC name | 3-bromo-6-(trifluoromethyl)pyridine-2-carbonitrile |
| InChIKey | GRYWQCYIUBGZKN-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1Br)C#N)C(F)(F)F |
Computed by PubChem (NCBI)