CAS 1211696-28-4 is the registry number for 4-(Piperidin-1-ylsulfonyl)piperazin-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-piperidin-1-ylsulfonylpiperazin-2-one (CAS 1211696-28-4) is a chemical compound with the molecular formula C9H17N3O3S and a molecular weight of 247.32 g/mol. IUPAC name: 4-piperidin-1-ylsulfonylpiperazin-2-one. InChIKey: OPLOUMOYNXCSRC-UHFFFAOYSA-N.
| Molecular formula | C9H17N3O3S |
|---|---|
| Molecular weight | 247.32 g/mol |
| IUPAC name | 4-piperidin-1-ylsulfonylpiperazin-2-one |
| InChIKey | OPLOUMOYNXCSRC-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)S(=O)(=O)N2CCNC(=O)C2 |
Computed by PubChem (NCBI)