Products 1211788-57-6
CAS 1211788-57-6 is the registry number for VU0519975. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(7-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-thiophen-2-ylpiperazine-1-carboxamide (CAS 1211788-57-6) is a chemical compound with the molecular formula C17H17ClN4OS2 and a molecular weight of 392.9 g/mol. IUPAC name: 4-(7-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-thiophen-2-ylpiperazine-1-carboxamide. InChIKey: ZBDVRNVEQYVMJX-UHFFFAOYSA-N.
| Molecular formula | C17H17ClN4OS2 |
|---|---|
| Molecular weight | 392.9 g/mol |
| IUPAC name | 4-(7-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-thiophen-2-ylpiperazine-1-carboxamide |
| InChIKey | ZBDVRNVEQYVMJX-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)Cl)SC(=N2)N3CCN(CC3)C(=O)NC4=CC=CS4 |
Computed by PubChem (NCBI)