CAS 1212061-06-7 is the registry number for 4-Benzyl-3-(4-nitrophenyl)-4h-1,2,4-triazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-benzyl-3-(4-nitrophenyl)-1,2,4-triazole (CAS 1212061-06-7) is a chemical compound with the molecular formula C15H12N4O2 and a molecular weight of 280.28 g/mol. IUPAC name: 4-benzyl-3-(4-nitrophenyl)-1,2,4-triazole. InChIKey: OFBBDRWCMGTHJU-UHFFFAOYSA-N.
| Molecular formula | C15H12N4O2 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | 4-benzyl-3-(4-nitrophenyl)-1,2,4-triazole |
| InChIKey | OFBBDRWCMGTHJU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=NN=C2C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)