CAS 1212076-16-8 appears in our catalog under these names: Trans (+/-)-tert-butyl 1-benzyl-4-(4-chlorophenyl) pyrrolidin-3-ylcarbamate, 95%, tert-Butyl (trans-1-benzyl-4-(4-chlorophenyl)pyrrolidin-3-yl)carbamate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg, 25mg.
Tert-butyl N-[(3S,4R)-1-benzyl-4-(4-chlorophenyl)pyrrolidin-3-yl]carbamate (CAS 1212076-16-8) is a chemical compound with the molecular formula C22H27ClN2O2 and a molecular weight of 386.9 g/mol. IUPAC name: tert-butyl N-[(3S,4R)-1-benzyl-4-(4-chlorophenyl)pyrrolidin-3-yl]carbamate. InChIKey: YVSJDIDTUPXEER-VQTJNVASSA-N.
| Molecular formula | C22H27ClN2O2 |
|---|---|
| Molecular weight | 386.9 g/mol |
| IUPAC name | tert-butyl N-[(3S,4R)-1-benzyl-4-(4-chlorophenyl)pyrrolidin-3-yl]carbamate |
| InChIKey | YVSJDIDTUPXEER-VQTJNVASSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CN(C[C@H]1C2=CC=C(C=C2)Cl)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)