Products 1212102-19-6
CAS 1212102-19-6 is the registry number for Cis-6-aminomethyl-cyclohex-3-enylamine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
(1S,6S)-6-(aminomethyl)cyclohex-3-en-1-amine;dihydrochloride (CAS 1212102-19-6) is a chemical compound with the molecular formula C7H16Cl2N2 and a molecular weight of 199.12 g/mol. IUPAC name: (1S,6S)-6-(aminomethyl)cyclohex-3-en-1-amine;dihydrochloride. InChIKey: HGZDPVIIRMZSOT-JFYKYWLVSA-N.
| Molecular formula | C7H16Cl2N2 |
|---|---|
| Molecular weight | 199.12 g/mol |
| IUPAC name | (1S,6S)-6-(aminomethyl)cyclohex-3-en-1-amine;dihydrochloride |
| InChIKey | HGZDPVIIRMZSOT-JFYKYWLVSA-N |
| SMILES | C1C=CC[C@@H]([C@@H]1CN)N.Cl.Cl |
Computed by PubChem (NCBI)