Products 1212104-62-5
CAS 1212104-62-5 is the registry number for (1R)-1-(5,6,7,8-Tetrahydronaphthalen-2-yl)ethan-1-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1R)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanamine (CAS 1212104-62-5) is a chemical compound with the molecular formula C12H17N and a molecular weight of 175.27 g/mol. IUPAC name: (1R)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanamine. InChIKey: YJZYMMDEDLLIIP-SECBINFHSA-N.
| Molecular formula | C12H17N |
|---|---|
| Molecular weight | 175.27 g/mol |
| IUPAC name | (1R)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanamine |
| InChIKey | YJZYMMDEDLLIIP-SECBINFHSA-N |
| SMILES | C[C@H](C1=CC2=C(CCCC2)C=C1)N |
Computed by PubChem (NCBI)