CAS 1212106-05-2 is the registry number for Trans-4-(methylamino)tetrahydrothiophene-3-ol 1,1-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
(3S,4S)-4-(methylamino)-1,1-dioxothiolan-3-ol (CAS 1212106-05-2) is a chemical compound with the molecular formula C5H11NO3S and a molecular weight of 165.21 g/mol. IUPAC name: (3S,4S)-4-(methylamino)-1,1-dioxothiolan-3-ol. InChIKey: AZDGOTPNJUNJNK-RFZPGFLSSA-N.
| Molecular formula | C5H11NO3S |
|---|---|
| Molecular weight | 165.21 g/mol |
| IUPAC name | (3S,4S)-4-(methylamino)-1,1-dioxothiolan-3-ol |
| InChIKey | AZDGOTPNJUNJNK-RFZPGFLSSA-N |
| SMILES | CN[C@@H]1CS(=O)(=O)C[C@H]1O |
Computed by PubChem (NCBI)