CAS 1212149-60-4 is the registry number for 2-((1S,4R)-2-azabicyclo(2.2.1)heptan-2-yl)acetic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g, 100mg.
2-[(1S,4R)-2-azabicyclo[2.2.1]heptan-2-yl]acetic acid (CAS 1212149-60-4) is a chemical compound with the molecular formula C8H13NO2 and a molecular weight of 155.19 g/mol. IUPAC name: 2-[(1S,4R)-2-azabicyclo[2.2.1]heptan-2-yl]acetic acid. InChIKey: UUDNITWWYBIYOX-RQJHMYQMSA-N.
| Molecular formula | C8H13NO2 |
|---|---|
| Molecular weight | 155.19 g/mol |
| IUPAC name | 2-[(1S,4R)-2-azabicyclo[2.2.1]heptan-2-yl]acetic acid |
| InChIKey | UUDNITWWYBIYOX-RQJHMYQMSA-N |
| SMILES | C1C[C@H]2C[C@@H]1CN2CC(=O)O |
Computed by PubChem (NCBI)