CAS 1212157-31-7 appears in our catalog under these names: Trans-4-(1-pyrrolidinyl)tetrahydro-3-furanamine, 95%, trans-4-(1-Pyrrolidinyl)tetrahydro-3-furanamine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 0,5g.
(3R,4R)-4-pyrrolidin-1-yloxolan-3-amine (CAS 1212157-31-7) is a chemical compound with the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. IUPAC name: (3R,4R)-4-pyrrolidin-1-yloxolan-3-amine. InChIKey: MPUPFMVCVAXZKQ-YUMQZZPRSA-N.
| Molecular formula | C8H16N2O |
|---|---|
| Molecular weight | 156.23 g/mol |
| IUPAC name | (3R,4R)-4-pyrrolidin-1-yloxolan-3-amine |
| InChIKey | MPUPFMVCVAXZKQ-YUMQZZPRSA-N |
| SMILES | C1CCN(C1)[C@H]2COC[C@@H]2N |
Computed by PubChem (NCBI)