CAS 1212171-08-8 is the registry number for Cis-(6-amino-cyclohex-3-enyl)-methanol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[(1R,6S)-6-aminocyclohex-3-en-1-yl]methanol;hydrochloride (CAS 1212171-08-8) is a chemical compound with the molecular formula C7H14ClNO and a molecular weight of 163.64 g/mol. IUPAC name: [(1R,6S)-6-aminocyclohex-3-en-1-yl]methanol;hydrochloride. InChIKey: LTSJCLXQPIIVMS-LEUCUCNGSA-N.
| Molecular formula | C7H14ClNO |
|---|---|
| Molecular weight | 163.64 g/mol |
| IUPAC name | [(1R,6S)-6-aminocyclohex-3-en-1-yl]methanol;hydrochloride |
| InChIKey | LTSJCLXQPIIVMS-LEUCUCNGSA-N |
| SMILES | C1C=CC[C@@H]([C@@H]1CO)N.Cl |
Computed by PubChem (NCBI)