Products 121219-16-7

CAS 121219-16-7 appears in our catalog under these names: 2,3–Difluorophenylboronic acid(contains varying amounts of Anhydride), 2,3-Difluorophenylboronic Acid (contains varying amounts of Anhydride), 2,3-Difluorophenylboronic acid 97%, 2,3-Difluorophenylboronic acid, 97%, 97%, 2,3-Difluorobenzeneboronic acid, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 10g, 500g, 1g.

Structural formula: {0} (CAS {1})

(2,3-difluorophenyl)boronic acid (CAS 121219-16-7) is a chemical compound with the molecular formula C6H5BF2O2 and a molecular weight of 157.91 g/mol. IUPAC name: (2,3-difluorophenyl)boronic acid. InChIKey: SZYXKFKWFYUOGZ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5BF2O2
Molecular weight157.91 g/mol
IUPAC name(2,3-difluorophenyl)boronic acid
InChIKeySZYXKFKWFYUOGZ-UHFFFAOYSA-N
SMILESB(C1=C(C(=CC=C1)F)F)(O)O

Computed by PubChem (NCBI)