Products 121219-20-3

CAS 121219-20-3 appears in our catalog under these names: 2,3-Difluoro-4-(n-hexyloxy)phenylboronic acid, 98%, 2,3-Difluoro-4-(n-hexyloxy)phenylboronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 25g, 5g.

Structural formula: {0} (CAS {1})

(2,3-difluoro-4-hexoxyphenyl)boronic acid (CAS 121219-20-3) is a chemical compound with the molecular formula C12H17BF2O3 and a molecular weight of 258.07 g/mol. IUPAC name: (2,3-difluoro-4-hexoxyphenyl)boronic acid. InChIKey: RCHOIHOUIPPIJY-UHFFFAOYSA-N.

Identity
Molecular formulaC12H17BF2O3
Molecular weight258.07 g/mol
IUPAC name(2,3-difluoro-4-hexoxyphenyl)boronic acid
InChIKeyRCHOIHOUIPPIJY-UHFFFAOYSA-N
SMILESB(C1=C(C(=C(C=C1)OCCCCCC)F)F)(O)O

Computed by PubChem (NCBI)