CAS 1212252-84-0 is the registry number for trans-2-Methylmorpholine-3-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
(2R,3S)-2-methylmorpholine-3-carboxylic acid (CAS 1212252-84-0) is a chemical compound with the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. IUPAC name: (2R,3S)-2-methylmorpholine-3-carboxylic acid. InChIKey: FTVXLBDGIPTBCP-UHNVWZDZSA-N.
| Molecular formula | C6H11NO3 |
|---|---|
| Molecular weight | 145.16 g/mol |
| IUPAC name | (2R,3S)-2-methylmorpholine-3-carboxylic acid |
| InChIKey | FTVXLBDGIPTBCP-UHNVWZDZSA-N |
| SMILES | C[C@@H]1[C@H](NCCO1)C(=O)O |
Computed by PubChem (NCBI)