CAS 1212264-50-0 appears in our catalog under these names: (S)-1-(2,4-Dimethoxyphenyl)ethanamine, 95+%, (1S)-1-(2,4-Dimethoxyphenyl)ethan-1-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 10g.
(1S)-1-(2,4-dimethoxyphenyl)ethanamine (CAS 1212264-50-0) is a chemical compound with the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. IUPAC name: (1S)-1-(2,4-dimethoxyphenyl)ethanamine. InChIKey: WZDFPSLDFRVYEU-ZETCQYMHSA-N.
| Molecular formula | C10H15NO2 |
|---|---|
| Molecular weight | 181.23 g/mol |
| IUPAC name | (1S)-1-(2,4-dimethoxyphenyl)ethanamine |
| InChIKey | WZDFPSLDFRVYEU-ZETCQYMHSA-N |
| SMILES | C[C@@H](C1=C(C=C(C=C1)OC)OC)N |
Computed by PubChem (NCBI)