CAS 1212272-03-1 appears in our catalog under these names: trans-2-Benzyloxycarbonylaminocyclobutanecarboxylic acid, 98%, trans-2-Benzyloxycarbonylaminocyclobutane-carboxylic acid, 98+%, trans-2-(Benzyloxycarbonylamino)cyclobutanecarboxylic acid, . Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar). Available pack sizes: 5g, 250mg, 1g, 10g.
Trans-(1R,2R)-2-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylic acid (CAS 1212272-03-1) is a chemical compound with the molecular formula C13H15NO4 and a molecular weight of 249.26 g/mol. IUPAC name: trans-(1R,2R)-2-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylic acid. InChIKey: ZNRUEEQIUVKKBL-GHMZBOCLSA-N.
| Molecular formula | C13H15NO4 |
|---|---|
| Molecular weight | 249.26 g/mol |
| IUPAC name | trans-(1R,2R)-2-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylic acid |
| InChIKey | ZNRUEEQIUVKKBL-GHMZBOCLSA-N |
| SMILES | C1C[C@H]([C@@H]1C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)