Products 1212331-13-9

CAS 1212331-13-9 is the registry number for Octahydrothieno[3,4-b]pyrazine 6,6-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.

Structural formula: {0} (CAS {1})

(4aR,7aS)-1,2,3,4,4a,5,7,7a-octahydrothieno[3,4-b]pyrazine 6,6-dioxide (CAS 1212331-13-9) is a chemical compound with the molecular formula C6H12N2O2S and a molecular weight of 176.24 g/mol. IUPAC name: (4aR,7aS)-1,2,3,4,4a,5,7,7a-octahydrothieno[3,4-b]pyrazine 6,6-dioxide. InChIKey: XBPSKZNDAZYXNY-OLQVQODUSA-N.

Identity
Molecular formulaC6H12N2O2S
Molecular weight176.24 g/mol
IUPAC name(4aR,7aS)-1,2,3,4,4a,5,7,7a-octahydrothieno[3,4-b]pyrazine 6,6-dioxide
InChIKeyXBPSKZNDAZYXNY-OLQVQODUSA-N
SMILESC1CN[C@H]2CS(=O)(=O)C[C@H]2N1

Computed by PubChem (NCBI)