CAS 1212331-13-9 is the registry number for Octahydrothieno[3,4-b]pyrazine 6,6-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.
(4aR,7aS)-1,2,3,4,4a,5,7,7a-octahydrothieno[3,4-b]pyrazine 6,6-dioxide (CAS 1212331-13-9) is a chemical compound with the molecular formula C6H12N2O2S and a molecular weight of 176.24 g/mol. IUPAC name: (4aR,7aS)-1,2,3,4,4a,5,7,7a-octahydrothieno[3,4-b]pyrazine 6,6-dioxide. InChIKey: XBPSKZNDAZYXNY-OLQVQODUSA-N.
| Molecular formula | C6H12N2O2S |
|---|---|
| Molecular weight | 176.24 g/mol |
| IUPAC name | (4aR,7aS)-1,2,3,4,4a,5,7,7a-octahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| InChIKey | XBPSKZNDAZYXNY-OLQVQODUSA-N |
| SMILES | C1CN[C@H]2CS(=O)(=O)C[C@H]2N1 |
Computed by PubChem (NCBI)