CAS 12126-50-0 appears in our catalog under these names: Bis(pentamethylcyclopentadienyl)iron, Bis(pentamethylcyclopentadienyl)iron(II) 98%, Ferrocene, 1,1',2,2',3,3',4,4',5,5'-decamethyl-, 98%, 98%, Bis(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)iron, 98%. Offered by: Thermo Scientific (Acros), Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg, 25g.
Iron(2+);bis(1,2,3,4,5-pentamethylcyclopenta-1,3-diene) (CAS 12126-50-0) is a chemical compound with the molecular formula C20H30Fe and a molecular weight of 326.3 g/mol. IUPAC name: iron(2+);bis(1,2,3,4,5-pentamethylcyclopenta-1,3-diene). InChIKey: SEYZDJPFVVXSRB-UHFFFAOYSA-N.
| Molecular formula | C20H30Fe |
|---|---|
| Molecular weight | 326.3 g/mol |
| IUPAC name | iron(2+);bis(1,2,3,4,5-pentamethylcyclopenta-1,3-diene) |
| InChIKey | SEYZDJPFVVXSRB-UHFFFAOYSA-N |
| SMILES | C[C-]1C(=C(C(=C1C)C)C)C.C[C-]1C(=C(C(=C1C)C)C)C.[Fe+2] |
Computed by PubChem (NCBI)