Products 1212805-36-1
CAS 1212805-36-1 is the registry number for (S)-2-(3-Chloro-2-fluoro-6-(trifluoromethyl)phenyl)pyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]pyrrolidine (CAS 1212805-36-1) is a chemical compound with the molecular formula C11H10ClF4N and a molecular weight of 267.65 g/mol. IUPAC name: (2S)-2-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]pyrrolidine. InChIKey: GRVNSHMPNXCEHT-QMMMGPOBSA-N.
| Molecular formula | C11H10ClF4N |
|---|---|
| Molecular weight | 267.65 g/mol |
| IUPAC name | (2S)-2-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]pyrrolidine |
| InChIKey | GRVNSHMPNXCEHT-QMMMGPOBSA-N |
| SMILES | C1C[C@H](NC1)C2=C(C=CC(=C2F)Cl)C(F)(F)F |
Computed by PubChem (NCBI)