CAS 1212815-04-7 is the registry number for (S)-2,2,2-Trifluoro-1-(3-fluoro-4-(trifluoromethyl)phenyl)ethan-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-2,2,2-trifluoro-1-[3-fluoro-4-(trifluoromethyl)phenyl]ethanamine (CAS 1212815-04-7) is a chemical compound with the molecular formula C9H6F7N and a molecular weight of 261.14 g/mol. IUPAC name: (1S)-2,2,2-trifluoro-1-[3-fluoro-4-(trifluoromethyl)phenyl]ethanamine. InChIKey: FBEWIBUBRPOPFD-ZETCQYMHSA-N.
| Molecular formula | C9H6F7N |
|---|---|
| Molecular weight | 261.14 g/mol |
| IUPAC name | (1S)-2,2,2-trifluoro-1-[3-fluoro-4-(trifluoromethyl)phenyl]ethanamine |
| InChIKey | FBEWIBUBRPOPFD-ZETCQYMHSA-N |
| SMILES | C1=CC(=C(C=C1[C@@H](C(F)(F)F)N)F)C(F)(F)F |
Computed by PubChem (NCBI)