CAS 1212823-28-3 appears in our catalog under these names: (S)-1-((1,2,4)Triazolo(4,3-a)pyridin-3-yl)ethanamine, 97%, (1S)-1-{(1,2,4)Triazolo(4,3-a)pyridin-3-yl}ethan-1-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 10g, 0,1g, 0,05g, 0,25g, 0,5g.
(1S)-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanamine (CAS 1212823-28-3) is a chemical compound with the molecular formula C8H10N4 and a molecular weight of 162.19 g/mol. IUPAC name: (1S)-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanamine. InChIKey: FQWYAIRHWCMQNP-LURJTMIESA-N.
| Molecular formula | C8H10N4 |
|---|---|
| Molecular weight | 162.19 g/mol |
| IUPAC name | (1S)-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanamine |
| InChIKey | FQWYAIRHWCMQNP-LURJTMIESA-N |
| SMILES | C[C@@H](C1=NN=C2N1C=CC=C2)N |
Computed by PubChem (NCBI)