Products 121286-63-3
CAS 121286-63-3 is the registry number for 3-Fluoro-2,6-diisopropylaniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-fluoro-2,6-di(propan-2-yl)aniline (CAS 121286-63-3) is a chemical compound with the molecular formula C12H18FN and a molecular weight of 195.28 g/mol. IUPAC name: 3-fluoro-2,6-di(propan-2-yl)aniline. InChIKey: DSDCZVHJVIVWJK-UHFFFAOYSA-N.
| Molecular formula | C12H18FN |
|---|---|
| Molecular weight | 195.28 g/mol |
| IUPAC name | 3-fluoro-2,6-di(propan-2-yl)aniline |
| InChIKey | DSDCZVHJVIVWJK-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=C(C=C1)F)C(C)C)N |
Computed by PubChem (NCBI)