Products 121286-64-4
CAS 121286-64-4 appears in our catalog under these names: 4-Fluoro-2,6-diisopropylaniline 95%, 4-Fluoro-2,6-diisopropylaniline, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-fluoro-2,6-di(propan-2-yl)aniline (CAS 121286-64-4) is a chemical compound with the molecular formula C12H18FN and a molecular weight of 195.28 g/mol. IUPAC name: 4-fluoro-2,6-di(propan-2-yl)aniline. InChIKey: ZIUMEJRMQJELRO-UHFFFAOYSA-N.
| Molecular formula | C12H18FN |
|---|---|
| Molecular weight | 195.28 g/mol |
| IUPAC name | 4-fluoro-2,6-di(propan-2-yl)aniline |
| InChIKey | ZIUMEJRMQJELRO-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1N)C(C)C)F |
Computed by PubChem (NCBI)