CAS 1212888-72-6 is the registry number for (R)-2-Amino-2-(2,6-difluorophenyl)ethan-1-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-amino-2-(2,6-difluorophenyl)ethanol (CAS 1212888-72-6) is a chemical compound with the molecular formula C8H9F2NO and a molecular weight of 173.16 g/mol. IUPAC name: (2R)-2-amino-2-(2,6-difluorophenyl)ethanol. InChIKey: FWVIIGPYZSXQGV-ZETCQYMHSA-N.
| Molecular formula | C8H9F2NO |
|---|---|
| Molecular weight | 173.16 g/mol |
| IUPAC name | (2R)-2-amino-2-(2,6-difluorophenyl)ethanol |
| InChIKey | FWVIIGPYZSXQGV-ZETCQYMHSA-N |
| SMILES | C1=CC(=C(C(=C1)F)[C@H](CO)N)F |
Computed by PubChem (NCBI)