Products 1212940-70-9
CAS 1212940-70-9 is the registry number for (2S)-2-AMINO-2-(3-CHLORO-2-FLUOROPHENYL)ETHAN-1-OL, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2S)-2-amino-2-(3-chloro-2-fluorophenyl)ethanol (CAS 1212940-70-9) is a chemical compound with the molecular formula C8H9ClFNO and a molecular weight of 189.61 g/mol. IUPAC name: (2S)-2-amino-2-(3-chloro-2-fluorophenyl)ethanol. InChIKey: TUGSNFQSUXFGGZ-SSDOTTSWSA-N.
| Molecular formula | C8H9ClFNO |
|---|---|
| Molecular weight | 189.61 g/mol |
| IUPAC name | (2S)-2-amino-2-(3-chloro-2-fluorophenyl)ethanol |
| InChIKey | TUGSNFQSUXFGGZ-SSDOTTSWSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)F)[C@@H](CO)N |
Computed by PubChem (NCBI)