CAS 1212996-56-9 appears in our catalog under these names: (R)-1-(5-Fluoro-2-methoxypyridin-3-yl)ethan-1-amine, 95%, (R)-1-(5-fluoro-2-methoxypyridin-3-yl)ethan-1-amine, 98%, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(1R)-1-(5-fluoro-2-methoxy-3-pyridinyl)ethanamine (CAS 1212996-56-9) is a chemical compound with the molecular formula C8H11FN2O and a molecular weight of 170.18 g/mol. IUPAC name: (1R)-1-(5-fluoro-2-methoxy-3-pyridinyl)ethanamine. InChIKey: SNKPNKLWTBUEMR-RXMQYKEDSA-N.
| Molecular formula | C8H11FN2O |
|---|---|
| Molecular weight | 170.18 g/mol |
| IUPAC name | (1R)-1-(5-fluoro-2-methoxy-3-pyridinyl)ethanamine |
| InChIKey | SNKPNKLWTBUEMR-RXMQYKEDSA-N |
| SMILES | C[C@H](C1=C(N=CC(=C1)F)OC)N |
Computed by PubChem (NCBI)