CAS 1213048-17-9 is the registry number for (R)-1-(2,4,5-Trimethylphenyl)butan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(2,4,5-trimethylphenyl)butan-1-amine (CAS 1213048-17-9) is a chemical compound with the molecular formula C13H21N and a molecular weight of 191.31 g/mol. IUPAC name: (1R)-1-(2,4,5-trimethylphenyl)butan-1-amine. InChIKey: PYFHOJYDHBYEHA-CYBMUJFWSA-N.
| Molecular formula | C13H21N |
|---|---|
| Molecular weight | 191.31 g/mol |
| IUPAC name | (1R)-1-(2,4,5-trimethylphenyl)butan-1-amine |
| InChIKey | PYFHOJYDHBYEHA-CYBMUJFWSA-N |
| SMILES | CCC[C@H](C1=C(C=C(C(=C1)C)C)C)N |
Computed by PubChem (NCBI)