CAS 1213050-04-4 is the registry number for (R)-3-(1-Aminoethyl)-5-fluorophenol, 98%. Offered by: AmBeed. Available pack sizes: 1g.
3-[(1R)-1-aminoethyl]-5-fluorophenol (CAS 1213050-04-4) is a chemical compound with the molecular formula C8H10FNO and a molecular weight of 155.17 g/mol. IUPAC name: 3-[(1R)-1-aminoethyl]-5-fluorophenol. InChIKey: BKULEEWYUPYHIK-RXMQYKEDSA-N.
| Molecular formula | C8H10FNO |
|---|---|
| Molecular weight | 155.17 g/mol |
| IUPAC name | 3-[(1R)-1-aminoethyl]-5-fluorophenol |
| InChIKey | BKULEEWYUPYHIK-RXMQYKEDSA-N |
| SMILES | C[C@H](C1=CC(=CC(=C1)F)O)N |
Computed by PubChem (NCBI)