CAS 1213089-00-9 is the registry number for (S)-6-(tert-Butyl)-2,3-dihydro-1H-inden-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-6-tert-butyl-2,3-dihydro-1H-inden-1-amine (CAS 1213089-00-9) is a chemical compound with the molecular formula C13H19N and a molecular weight of 189.30 g/mol. IUPAC name: (1S)-6-tert-butyl-2,3-dihydro-1H-inden-1-amine. InChIKey: DMJGSGUUPYFGBN-LBPRGKRZSA-N.
| Molecular formula | C13H19N |
|---|---|
| Molecular weight | 189.30 g/mol |
| IUPAC name | (1S)-6-tert-butyl-2,3-dihydro-1H-inden-1-amine |
| InChIKey | DMJGSGUUPYFGBN-LBPRGKRZSA-N |
| SMILES | CC(C)(C)C1=CC2=C(CC[C@@H]2N)C=C1 |
Computed by PubChem (NCBI)