CAS 121309-88-4 appears in our catalog under these names: Benzyltrimethylammonium tetrachloroiodate, Benzyltrimethylammonium Tetrachloroiodate [Chlorinating Reagent], >95.0%(T), Benzyltrimethylammonium tetrachloroiodate 98%, Benzyltrimethylammonium tetrachloroiodate, 98.49%, Benzyltrimethylammonium tetrachloroiodate, 98%. Offered by: GLPBio, TCI, Ambeed, MedChemExpress, Fluorochem. Available pack sizes: 10g, 5g, 250mg, 1g, 25g, 1 g, 5 g, 500 mg.
CAS 121309-88-4 identifies a chemical compound with the molecular formula C10H16Cl4IN and a molecular weight of 419.0 g/mol. InChIKey: IBXYFQYYVRYALP-UHFFFAOYSA-N.
| Molecular formula | C10H16Cl4IN |
|---|---|
| Molecular weight | 419.0 g/mol |
| InChIKey | IBXYFQYYVRYALP-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)CC1=CC=CC=C1.Cl[I-](Cl)(Cl)Cl |
Computed by PubChem (NCBI)