CAS 1213113-08-6 is the registry number for (1R,2R)-1-Amino-1-(thiophen-2-yl)propan-2-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,2R)-1-amino-1-thiophen-2-ylpropan-2-ol (CAS 1213113-08-6) is a chemical compound with the molecular formula C7H11NOS and a molecular weight of 157.24 g/mol. IUPAC name: (1R,2R)-1-amino-1-thiophen-2-ylpropan-2-ol. InChIKey: XJNSOYHPOFVGNB-IYSWYEEDSA-N.
| Molecular formula | C7H11NOS |
|---|---|
| Molecular weight | 157.24 g/mol |
| IUPAC name | (1R,2R)-1-amino-1-thiophen-2-ylpropan-2-ol |
| InChIKey | XJNSOYHPOFVGNB-IYSWYEEDSA-N |
| SMILES | C[C@H]([C@H](C1=CC=CS1)N)O |
Computed by PubChem (NCBI)