CAS 1213113-97-3 appears in our catalog under these names: (S)-1-(3-Bromopyridin-2-yl)ethanamine, 97%, (S)-1-(3-Bromopyridin-2-yl)ethanamine, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
(1S)-1-(3-bromo-2-pyridinyl)ethanamine (CAS 1213113-97-3) is a chemical compound with the molecular formula C7H9BrN2 and a molecular weight of 201.06 g/mol. IUPAC name: (1S)-1-(3-bromo-2-pyridinyl)ethanamine. InChIKey: SVDQMJUOIHNSKT-YFKPBYRVSA-N.
| Molecular formula | C7H9BrN2 |
|---|---|
| Molecular weight | 201.06 g/mol |
| IUPAC name | (1S)-1-(3-bromo-2-pyridinyl)ethanamine |
| InChIKey | SVDQMJUOIHNSKT-YFKPBYRVSA-N |
| SMILES | C[C@@H](C1=C(C=CC=N1)Br)N |
Computed by PubChem (NCBI)