Products 1213135-36-4
CAS 1213135-36-4 is the registry number for (3S)-4-Chloro-2,3-dihydrobenzo[b]furan-3-ylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(3S)-4-chloro-2,3-dihydro-1-benzofuran-3-amine (CAS 1213135-36-4) is a chemical compound with the molecular formula C8H8ClNO and a molecular weight of 169.61 g/mol. IUPAC name: (3S)-4-chloro-2,3-dihydro-1-benzofuran-3-amine. InChIKey: JQGZTFSBYXGAEC-ZCFIWIBFSA-N.
| Molecular formula | C8H8ClNO |
|---|---|
| Molecular weight | 169.61 g/mol |
| IUPAC name | (3S)-4-chloro-2,3-dihydro-1-benzofuran-3-amine |
| InChIKey | JQGZTFSBYXGAEC-ZCFIWIBFSA-N |
| SMILES | C1[C@H](C2=C(O1)C=CC=C2Cl)N |
Computed by PubChem (NCBI)